C15H18BrNO2 — CID 104652643
N-[1-(5-bromofuran-2-yl)ethyl]-3-methoxy-2,4-dimethylaniline (PubChem CID 104652643) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-yl)ethyl]-3-methoxy-2,4-dimethylaniline.
| Compound Name | N-[1-(5-bromofuran-2-yl)ethyl]-3-methoxy-2,4-dimethylaniline |
|---|---|
| PubChem CID | 104652643 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[1-(5-bromofuran-2-yl)ethyl]-3-methoxy-2,4-dimethylaniline |
| SMILES | COc1c(C)ccc(NC(C)c2ccc(Br)o2)c1C |
| InChI | InChI=1S/C15H18BrNO2/c1-9-5-6-12(10(2)15(9)18-4)17-11(3)13-7-8-14(16)19-13/h5-8,11,17H,1-4H3 |
| InChIKey | XAFNJGIHSQDGBF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |