C13H14ClNO4S — CID 104656470
4-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-2-chlorobenzoic acid (PubChem CID 104656470) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-2-chlorobenzoic acid.
| Compound Name | 4-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 104656470 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-2-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CC3CCC2C3)cc1Cl |
| InChI | InChI=1S/C13H14ClNO4S/c14-12-6-10(3-4-11(12)13(16)17)20(18,19)15-7-8-1-2-9(15)5-8/h3-4,6,8-9H,1-2,5,7H2,(H,16,17) |
| InChIKey | IOSJUKHQWJGTIU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |