C12H14ClNO5S — CID 107216439
2-chloro-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzoic acid (PubChem CID 107216439) has the molecular formula C12H14ClNO5S and a molecular weight of 319.77 g/mol. Its IUPAC name is 2-chloro-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107216439 |
| Molecular Formula | C12H14ClNO5S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-chloro-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCC[C@H](O)C2)cc1Cl |
| InChI | InChI=1S/C12H14ClNO5S/c13-11-6-9(3-4-10(11)12(16)17)20(18,19)14-5-1-2-8(15)7-14/h3-4,6,8,15H,1-2,5,7H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | TUDXDJXHWJNAAL-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |