C11H15BrN2O3S — CID 107213789
(3S)-1-(3-amino-4-bromophenyl)sulfonylpiperidin-3-ol (PubChem CID 107213789) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is (3S)-1-(3-amino-4-bromophenyl)sulfonylpiperidin-3-ol.
| Compound Name | (3S)-1-(3-amino-4-bromophenyl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 107213789 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | (3S)-1-(3-amino-4-bromophenyl)sulfonylpiperidin-3-ol |
| SMILES | Nc1cc(S(=O)(=O)N2CCC[C@H](O)C2)ccc1Br |
| InChI | InChI=1S/C11H15BrN2O3S/c12-10-4-3-9(6-11(10)13)18(16,17)14-5-1-2-8(15)7-14/h3-4,6,8,15H,1-2,5,7,13H2/t8-/m0/s1 |
| InChIKey | QQRAIAVVBQMWMQ-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|