C10H15BrN4O4S2 — CID 115329028
4-(3-amino-4-bromophenyl)sulfonylpiperazine-1-sulfonamide (PubChem CID 115329028) has the molecular formula C10H15BrN4O4S2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 4-(3-amino-4-bromophenyl)sulfonylpiperazine-1-sulfonamide.
| Compound Name | 4-(3-amino-4-bromophenyl)sulfonylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 115329028 |
| Molecular Formula | C10H15BrN4O4S2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 4-(3-amino-4-bromophenyl)sulfonylpiperazine-1-sulfonamide |
| SMILES | Nc1cc(S(=O)(=O)N2CCN(S(N)(=O)=O)CC2)ccc1Br |
| InChI | InChI=1S/C10H15BrN4O4S2/c11-9-2-1-8(7-10(9)12)20(16,17)14-3-5-15(6-4-14)21(13,18)19/h1-2,7H,3-6,12H2,(H2,13,18,19) |
| InChIKey | SQFXGAMMBQPEKN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|