C11H16O4 — CID 10465776
methyl 2-[(1R,3aR,6aS)-1-hydroxy-4-oxo-1,2,3,5,6,6a-hexahydropentalen-3a-yl]acetate (PubChem CID 10465776) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl 2-[(1R,3aR,6aS)-1-hydroxy-4-oxo-1,2,3,5,6,6a-hexahydropentalen-3a-yl]acetate.
| Compound Name | methyl 2-[(1R,3aR,6aS)-1-hydroxy-4-oxo-1,2,3,5,6,6a-hexahydropentalen-3a-yl]acetate |
|---|---|
| PubChem CID | 10465776 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl 2-[(1R,3aR,6aS)-1-hydroxy-4-oxo-1,2,3,5,6,6a-hexahydropentalen-3a-yl]acetate |
| SMILES | COC(=O)C[C@]12CC[C@@H](O)[C@H]1CCC2=O |
| InChI | InChI=1S/C11H16O4/c1-15-10(14)6-11-5-4-8(12)7(11)2-3-9(11)13/h7-8,12H,2-6H2,1H3/t7-,8-,11-/m1/s1 |
| InChIKey | PPPUZTHTGPMBIB-SOCHQFKDSA-N |
| XLogP | 0.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |