C12H22O3 — CID 10465840
(E,5S,8R)-8-hydroxy-5-methoxy-2,2-dimethylnon-6-en-3-one (PubChem CID 10465840) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E,5S,8R)-8-hydroxy-5-methoxy-2,2-dimethylnon-6-en-3-one.
| Compound Name | (E,5S,8R)-8-hydroxy-5-methoxy-2,2-dimethylnon-6-en-3-one |
|---|---|
| PubChem CID | 10465840 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E,5S,8R)-8-hydroxy-5-methoxy-2,2-dimethylnon-6-en-3-one |
| SMILES | CO[C@H](/C=C/[C@@H](C)O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O3/c1-9(13)6-7-10(15-5)8-11(14)12(2,3)4/h6-7,9-10,13H,8H2,1-5H3/b7-6+/t9-,10-/m1/s1 |
| InChIKey | HJOJBRBFSMXTRD-UHHSMLKOSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|