C13H18O5S — CID 104658539
3-[2-(2-methoxyethoxy)phenyl]-1,1-dioxothiolan-3-ol (PubChem CID 104658539) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)phenyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 3-[2-(2-methoxyethoxy)phenyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 104658539 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)phenyl]-1,1-dioxothiolan-3-ol |
| SMILES | COCCOc1ccccc1C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18O5S/c1-17-7-8-18-12-5-3-2-4-11(12)13(14)6-9-19(15,16)10-13/h2-5,14H,6-10H2,1H3 |
| InChIKey | BVFKVTUNWZYAMG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|