C18H28O3 — CID 104659592
(4,4-dimethylcyclohexyl)-[2-(2-methoxyethoxy)phenyl]methanol (PubChem CID 104659592) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl)-[2-(2-methoxyethoxy)phenyl]methanol.
| Compound Name | (4,4-dimethylcyclohexyl)-[2-(2-methoxyethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 104659592 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (4,4-dimethylcyclohexyl)-[2-(2-methoxyethoxy)phenyl]methanol |
| SMILES | COCCOc1ccccc1C(O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H28O3/c1-18(2)10-8-14(9-11-18)17(19)15-6-4-5-7-16(15)21-13-12-20-3/h4-7,14,17,19H,8-13H2,1-3H3 |
| InChIKey | GAWNZDAASNMQIQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|