C15H12BrCl2NO2 — CID 104662563
(3-amino-4,5-dichlorophenyl)-(3-bromo-4-ethoxyphenyl)methanone (PubChem CID 104662563) has the molecular formula C15H12BrCl2NO2 and a molecular weight of 389.08 g/mol. Its IUPAC name is (3-amino-4,5-dichlorophenyl)-(3-bromo-4-ethoxyphenyl)methanone.
| Compound Name | (3-amino-4,5-dichlorophenyl)-(3-bromo-4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 104662563 |
| Molecular Formula | C15H12BrCl2NO2 |
| Molecular Weight | 389.08 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | (3-amino-4,5-dichlorophenyl)-(3-bromo-4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2cc(N)c(Cl)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C15H12BrCl2NO2/c1-2-21-13-4-3-8(5-10(13)16)15(20)9-6-11(17)14(18)12(19)7-9/h3-7H,2,19H2,1H3 |
| InChIKey | DAIHCEUJJUPXQA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.08 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|