C13H23NO2 — CID 104663612
3-[1-(furan-2-yl)ethylamino]-4,4-dimethylpentan-1-ol (PubChem CID 104663612) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)ethylamino]-4,4-dimethylpentan-1-ol.
| Compound Name | 3-[1-(furan-2-yl)ethylamino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 104663612 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-[1-(furan-2-yl)ethylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(NC(CCO)C(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C13H23NO2/c1-10(11-6-5-9-16-11)14-12(7-8-15)13(2,3)4/h5-6,9-10,12,14-15H,7-8H2,1-4H3 |
| InChIKey | IBUSMQUZFCFDNV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |