About 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol
3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol (PubChem CID 104926046) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol |
| PubChem CID | 104926046 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol |
| SMILES | Cc1cc(C)cc(C(C)NC(CCO)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H29NO/c1-12-9-13(2)11-15(10-12)14(3)18-16(7-8-19)17(4,5)6/h9-11,14,16,18-19H,7-8H2,1-6H3 |
| InChIKey | OYCOWMWPRFPAAW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol?
The IUPAC name of 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol (CID 104926046) is 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol?
The canonical SMILES for 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol is Cc1cc(C)cc(C(C)NC(CCO)C(C)(C)C)c1.
What is the InChIKey of 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol?
The InChIKey is OYCOWMWPRFPAAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO/c1-12-9-13(2)11-15(10-12)14(3)18-16(7-8-19)17(4,5)6/h9-11,14,16,18-19H,7-8H2,1-6H3.
What are the key properties of 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol?
3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol has a molecular weight of 263.43 g/mol, XLogP of 3.75, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,5-dimethylphenyl)ethylamino]-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 104926046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).