C12H22N2OS — CID 104925969
4,4-dimethyl-3-[1-(1,3-thiazol-4-yl)ethylamino]pentan-1-ol (PubChem CID 104925969) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 4,4-dimethyl-3-[1-(1,3-thiazol-4-yl)ethylamino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-[1-(1,3-thiazol-4-yl)ethylamino]pentan-1-ol |
|---|---|
| PubChem CID | 104925969 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4,4-dimethyl-3-[1-(1,3-thiazol-4-yl)ethylamino]pentan-1-ol |
| SMILES | CC(NC(CCO)C(C)(C)C)c1cscn1 |
| InChI | InChI=1S/C12H22N2OS/c1-9(10-7-16-8-13-10)14-11(5-6-15)12(2,3)4/h7-9,11,14-15H,5-6H2,1-4H3 |
| InChIKey | GOJAICIETLWTCZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |