C19H21Cl2N3O2S — CID 1046648
N,N-bis(2-chloroethyl)-4-[(1-methylsulfonylbenzimidazol-2-yl)methyl]aniline (PubChem CID 1046648) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-4-[(1-methylsulfonylbenzimidazol-2-yl)methyl]aniline.
| Compound Name | N,N-bis(2-chloroethyl)-4-[(1-methylsulfonylbenzimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 1046648 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N,N-bis(2-chloroethyl)-4-[(1-methylsulfonylbenzimidazol-2-yl)methyl]aniline |
| SMILES | CS(=O)(=O)n1c(Cc2ccc(N(CCCl)CCCl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C19H21Cl2N3O2S/c1-27(25,26)24-18-5-3-2-4-17(18)22-19(24)14-15-6-8-16(9-7-15)23(12-10-20)13-11-21/h2-9H,10-14H2,1H3 |
| InChIKey | SDDVQNAGYKKBEL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|