C22H20N2O4S — CID 11589588
1-(benzenesulfonyl)-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole (PubChem CID 11589588) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole.
| Compound Name | 1-(benzenesulfonyl)-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 11589588 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[(3,4-dimethoxyphenyl)methyl]benzimidazole |
| SMILES | COc1ccc(Cc2nc3ccccc3n2S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H20N2O4S/c1-27-20-13-12-16(14-21(20)28-2)15-22-23-18-10-6-7-11-19(18)24(22)29(25,26)17-8-4-3-5-9-17/h3-14H,15H2,1-2H3 |
| InChIKey | AYAHPQQDOQKTHV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |