C15H21ClN2O2 — CID 104667369
N-(4-amino-5-chloro-2-methylphenyl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 104667369) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is N-(4-amino-5-chloro-2-methylphenyl)-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-(4-amino-5-chloro-2-methylphenyl)-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 104667369 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(4-amino-5-chloro-2-methylphenyl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | Cc1cc(N)c(Cl)cc1NC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C15H21ClN2O2/c1-7-5-12(17)11(16)6-13(7)18-15(19)14-8(2)9(3)20-10(14)4/h5-6,8-10,14H,17H2,1-4H3,(H,18,19) |
| InChIKey | HCKMVMOMQSQDCP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|