C15H19ClN2O2S — CID 65155869
N-(2-carbamothioyl-5-chlorophenyl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65155869) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is N-(2-carbamothioyl-5-chlorophenyl)-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-(2-carbamothioyl-5-chlorophenyl)-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 65155869 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(2-carbamothioyl-5-chlorophenyl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)Nc2cc(Cl)ccc2C(N)=S)C1C |
| InChI | InChI=1S/C15H19ClN2O2S/c1-7-8(2)20-9(3)13(7)15(19)18-12-6-10(16)4-5-11(12)14(17)21/h4-9,13H,1-3H3,(H2,17,21)(H,18,19) |
| InChIKey | FEKCVVTVFZRNFJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|