C13H11ClN2O2S — CID 64917019
N-(2-carbamothioyl-5-chlorophenyl)-3-methylfuran-2-carboxamide (PubChem CID 64917019) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is N-(2-carbamothioyl-5-chlorophenyl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(2-carbamothioyl-5-chlorophenyl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 64917019 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | N-(2-carbamothioyl-5-chlorophenyl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1cc(Cl)ccc1C(N)=S |
| InChI | InChI=1S/C13H11ClN2O2S/c1-7-4-5-18-11(7)13(17)16-10-6-8(14)2-3-9(10)12(15)19/h2-6H,1H3,(H2,15,19)(H,16,17) |
| InChIKey | BNAWLPVRGDIDAO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|