C13H15N3O3 — CID 104669802
4-[(3,6-dimethylpyridazine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 104669802) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[(3,6-dimethylpyridazine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(3,6-dimethylpyridazine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104669802 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-[(3,6-dimethylpyridazine-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | Cc1cc(C(=O)NC2C=CC(C(=O)O)C2)c(C)nn1 |
| InChI | InChI=1S/C13H15N3O3/c1-7-5-11(8(2)16-15-7)12(17)14-10-4-3-9(6-10)13(18)19/h3-5,9-10H,6H2,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | VFHFBPBTDOWTKX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|