C14H26N4O — CID 104670206
2-N-[(3-ethyl-6-methylpyridazin-4-yl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine (PubChem CID 104670206) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-N-[(3-ethyl-6-methylpyridazin-4-yl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine.
| Compound Name | 2-N-[(3-ethyl-6-methylpyridazin-4-yl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 104670206 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-N-[(3-ethyl-6-methylpyridazin-4-yl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine |
| SMILES | CCc1nnc(C)cc1CNC(C)CNCCOC |
| InChI | InChI=1S/C14H26N4O/c1-5-14-13(8-11(2)17-18-14)10-16-12(3)9-15-6-7-19-4/h8,12,15-16H,5-7,9-10H2,1-4H3 |
| InChIKey | AQFQPNDQTJOFBG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|