C12H20FN3O — CID 113452860
2-N-[(5-fluoro-3-pyridinyl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine (PubChem CID 113452860) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-N-[(5-fluoro-3-pyridinyl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine.
| Compound Name | 2-N-[(5-fluoro-3-pyridinyl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 113452860 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-N-[(5-fluoro-3-pyridinyl)methyl]-1-N-(2-methoxyethyl)propane-1,2-diamine |
| SMILES | COCCNCC(C)NCc1cncc(F)c1 |
| InChI | InChI=1S/C12H20FN3O/c1-10(6-14-3-4-17-2)16-8-11-5-12(13)9-15-7-11/h5,7,9-10,14,16H,3-4,6,8H2,1-2H3 |
| InChIKey | CPUJAAJBNDCJPJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|