C9H14N4O — CID 104671511
N-methyl-N-[2-(methylamino)ethyl]pyridazine-4-carboxamide (PubChem CID 104671511) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)ethyl]pyridazine-4-carboxamide.
| Compound Name | N-methyl-N-[2-(methylamino)ethyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104671511 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-methyl-N-[2-(methylamino)ethyl]pyridazine-4-carboxamide |
| SMILES | CNCCN(C)C(=O)c1ccnnc1 |
| InChI | InChI=1S/C9H14N4O/c1-10-5-6-13(2)9(14)8-3-4-11-12-7-8/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | XXWUEFPICXKAGZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |