C11H15N3O2 — CID 104671170
N-[(3-hydroxycyclobutyl)methyl]-N-methylpyridazine-4-carboxamide (PubChem CID 104671170) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]-N-methylpyridazine-4-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]-N-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104671170 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]-N-methylpyridazine-4-carboxamide |
| SMILES | CN(CC1CC(O)C1)C(=O)c1ccnnc1 |
| InChI | InChI=1S/C11H15N3O2/c1-14(7-8-4-10(15)5-8)11(16)9-2-3-12-13-6-9/h2-3,6,8,10,15H,4-5,7H2,1H3 |
| InChIKey | GSTPAIQBAXWQBK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |