C14H20N6O — CID 104672191
3-(1-piperazin-1-ylbutyl)-5-pyridazin-4-yl-1,2,4-oxadiazole (PubChem CID 104672191) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-(1-piperazin-1-ylbutyl)-5-pyridazin-4-yl-1,2,4-oxadiazole.
| Compound Name | 3-(1-piperazin-1-ylbutyl)-5-pyridazin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104672191 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-(1-piperazin-1-ylbutyl)-5-pyridazin-4-yl-1,2,4-oxadiazole |
| SMILES | CCCC(c1noc(-c2ccnnc2)n1)N1CCNCC1 |
| InChI | InChI=1S/C14H20N6O/c1-2-3-12(20-8-6-15-7-9-20)13-18-14(21-19-13)11-4-5-16-17-10-11/h4-5,10,12,15H,2-3,6-9H2,1H3 |
| InChIKey | RUHJKKJAZJFIOI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 79.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |