C14H20N4OS — CID 63342810
3-(1-piperazin-1-ylbutyl)-5-thiophen-3-yl-1,2,4-oxadiazole (PubChem CID 63342810) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 3-(1-piperazin-1-ylbutyl)-5-thiophen-3-yl-1,2,4-oxadiazole.
| Compound Name | 3-(1-piperazin-1-ylbutyl)-5-thiophen-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63342810 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-(1-piperazin-1-ylbutyl)-5-thiophen-3-yl-1,2,4-oxadiazole |
| SMILES | CCCC(c1noc(-c2ccsc2)n1)N1CCNCC1 |
| InChI | InChI=1S/C14H20N4OS/c1-2-3-12(18-7-5-15-6-8-18)13-16-14(19-17-13)11-4-9-20-10-11/h4,9-10,12,15H,2-3,5-8H2,1H3 |
| InChIKey | CZFCJKOSDOQEIS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |