C11H11Cl3O2 — CID 104673772
1,4-dichloro-2-(3-chloro-2-methoxycyclobutyl)oxybenzene (PubChem CID 104673772) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is 1,4-dichloro-2-(3-chloro-2-methoxycyclobutyl)oxybenzene.
| Compound Name | 1,4-dichloro-2-(3-chloro-2-methoxycyclobutyl)oxybenzene |
|---|---|
| PubChem CID | 104673772 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 1,4-dichloro-2-(3-chloro-2-methoxycyclobutyl)oxybenzene |
| SMILES | COC1C(Cl)CC1Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11Cl3O2/c1-15-11-8(14)5-10(11)16-9-4-6(12)2-3-7(9)13/h2-4,8,10-11H,5H2,1H3 |
| InChIKey | OTTVFFRZLYRQJJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|