About 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol
2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol (PubChem CID 104675458) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol |
| PubChem CID | 104675458 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol |
| SMILES | CCOC1C(O)CC1Oc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H17N3O3/c1-2-19-13-11(18)8-12(13)20-14-15-9-17(16-14)10-6-4-3-5-7-10/h3-7,9,11-13,18H,2,8H2,1H3 |
| InChIKey | MSRKIMAVALDPNZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol?
The IUPAC name of 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol (CID 104675458) is 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol.
What is the SMILES notation for 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol?
The canonical SMILES for 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol is CCOC1C(O)CC1Oc1ncn(-c2ccccc2)n1.
What is the InChIKey of 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol?
The InChIKey is MSRKIMAVALDPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-2-19-13-11(18)8-12(13)20-14-15-9-17(16-14)10-6-4-3-5-7-10/h3-7,9,11-13,18H,2,8H2,1H3.
What are the key properties of 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol?
2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol has a molecular weight of 275.31 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]cyclobutan-1-ol is sourced from PubChem (CID 104675458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).