C12H9FN6 — CID 10467579
3-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]pyrazin-2-amine (PubChem CID 10467579) has the molecular formula C12H9FN6 and a molecular weight of 256.24 g/mol. Its IUPAC name is 3-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]pyrazin-2-amine.
| Compound Name | 3-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 10467579 |
| Molecular Formula | C12H9FN6 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]pyrazin-2-amine |
| SMILES | Nc1nccnc1-c1nc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C12H9FN6/c13-8-4-2-1-3-7(8)11-17-12(19-18-11)9-10(14)16-6-5-15-9/h1-6H,(H2,14,16)(H,17,18,19) |
| InChIKey | WDXNPPVSCHUBPX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |