C15H13FN4 — CID 97287235
(R)-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]-phenylmethanamine (PubChem CID 97287235) has the molecular formula C15H13FN4 and a molecular weight of 268.30 g/mol. Its IUPAC name is (R)-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]-phenylmethanamine.
| Compound Name | (R)-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]-phenylmethanamine |
|---|---|
| PubChem CID | 97287235 |
| Molecular Formula | C15H13FN4 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (R)-[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]-phenylmethanamine |
| SMILES | N[C@H](c1ccccc1)c1nc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C15H13FN4/c16-12-9-5-4-8-11(12)14-18-15(20-19-14)13(17)10-6-2-1-3-7-10/h1-9,13H,17H2,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | VRSNLKDIOXNJCB-CYBMUJFWSA-N |
| XLogP | 2.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |