C13H18N4 — CID 97287252
(R)-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-phenylmethanamine (PubChem CID 97287252) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is (R)-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-phenylmethanamine.
| Compound Name | (R)-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-phenylmethanamine |
|---|---|
| PubChem CID | 97287252 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (R)-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-phenylmethanamine |
| SMILES | CC(C)(C)c1n[nH]c([C@H](N)c2ccccc2)n1 |
| InChI | InChI=1S/C13H18N4/c1-13(2,3)12-15-11(16-17-12)10(14)9-7-5-4-6-8-9/h4-8,10H,14H2,1-3H3,(H,15,16,17)/t10-/m1/s1 |
| InChIKey | GKJPWHHNBMDOLA-SNVBAGLBSA-N |
| XLogP | 2.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |