C14H19F2NO2 — CID 104676497
3-(2,3-difluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine (PubChem CID 104676497) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-(2,3-difluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine.
| Compound Name | 3-(2,3-difluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 104676497 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-(2,3-difluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine |
| SMILES | CCNC1CC(Oc2cccc(F)c2F)C1OCC |
| InChI | InChI=1S/C14H19F2NO2/c1-3-17-10-8-12(14(10)18-4-2)19-11-7-5-6-9(15)13(11)16/h5-7,10,12,14,17H,3-4,8H2,1-2H3 |
| InChIKey | HGMHSLAFGUQXCD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |