C14H19BrFNO2 — CID 104676686
3-(3-bromo-4-fluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine (PubChem CID 104676686) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine.
| Compound Name | 3-(3-bromo-4-fluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 104676686 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-(3-bromo-4-fluorophenoxy)-2-ethoxy-N-ethylcyclobutan-1-amine |
| SMILES | CCNC1CC(Oc2ccc(F)c(Br)c2)C1OCC |
| InChI | InChI=1S/C14H19BrFNO2/c1-3-17-12-8-13(14(12)18-4-2)19-9-5-6-11(16)10(15)7-9/h5-7,12-14,17H,3-4,8H2,1-2H3 |
| InChIKey | KSMQRCFZGODTIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |