C13H16F2N2O4 — CID 104676512
3-(2,5-difluoro-4-nitrophenoxy)-2-ethoxy-N-methylcyclobutan-1-amine (PubChem CID 104676512) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-nitrophenoxy)-2-ethoxy-N-methylcyclobutan-1-amine.
| Compound Name | 3-(2,5-difluoro-4-nitrophenoxy)-2-ethoxy-N-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 104676512 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-(2,5-difluoro-4-nitrophenoxy)-2-ethoxy-N-methylcyclobutan-1-amine |
| SMILES | CCOC1C(NC)CC1Oc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H16F2N2O4/c1-3-20-13-9(16-2)6-12(13)21-11-5-7(14)10(17(18)19)4-8(11)15/h4-5,9,12-13,16H,3,6H2,1-2H3 |
| InChIKey | HTIYCRRKQXNHBE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|