C9H8F2N2O3 — CID 63597612
3-(2,5-difluoro-4-nitrophenoxy)azetidine (PubChem CID 63597612) has the molecular formula C9H8F2N2O3 and a molecular weight of 230.17 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-nitrophenoxy)azetidine.
| Compound Name | 3-(2,5-difluoro-4-nitrophenoxy)azetidine |
|---|---|
| PubChem CID | 63597612 |
| Molecular Formula | C9H8F2N2O3 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-(2,5-difluoro-4-nitrophenoxy)azetidine |
| SMILES | O=[N+]([O-])c1cc(F)c(OC2CNC2)cc1F |
| InChI | InChI=1S/C9H8F2N2O3/c10-6-2-9(16-5-3-12-4-5)7(11)1-8(6)13(14)15/h1-2,5,12H,3-4H2 |
| InChIKey | QKTHLGJJCSUMNZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|