C20H20F6N2O4S — CID 1046773
methyl 2-[[1,1,1,3,3,3-hexafluoro-2-(furan-2-carbonylamino)propan-2-yl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 1046773) has the molecular formula C20H20F6N2O4S and a molecular weight of 498.45 g/mol. Its IUPAC name is methyl 2-[[1,1,1,3,3,3-hexafluoro-2-(furan-2-carbonylamino)propan-2-yl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[1,1,1,3,3,3-hexafluoro-2-(furan-2-carbonylamino)propan-2-yl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1046773 |
| Molecular Formula | C20H20F6N2O4S |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | methyl 2-[[1,1,1,3,3,3-hexafluoro-2-(furan-2-carbonylamino)propan-2-yl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(NC(=O)c2ccco2)(C(F)(F)F)C(F)(F)F)sc2c1CCCCCC2 |
| InChI | InChI=1S/C20H20F6N2O4S/c1-31-17(30)14-11-7-4-2-3-5-9-13(11)33-16(14)28-18(19(21,22)23,20(24,25)26)27-15(29)12-8-6-10-32-12/h6,8,10,28H,2-5,7,9H2,1H3,(H,27,29) |
| InChIKey | HTNWBISPHUUTTA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|