C15H28N2O3 — CID 104678478
2-[1-(aminomethyl)cyclohexyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide (PubChem CID 104678478) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 104678478 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide |
| SMILES | NCC1(CC(=O)NCC2(O)CCOCC2)CCCCC1 |
| InChI | InChI=1S/C15H28N2O3/c16-11-14(4-2-1-3-5-14)10-13(18)17-12-15(19)6-8-20-9-7-15/h19H,1-12,16H2,(H,17,18) |
| InChIKey | SHCLUEIUABRUQG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |