C16H27NO4 — CID 65108169
2-[1-[2-[(1-hydroxycyclopentyl)methylamino]-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 65108169) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[1-[2-[(1-hydroxycyclopentyl)methylamino]-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-[(1-hydroxycyclopentyl)methylamino]-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 65108169 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-[1-[2-[(1-hydroxycyclopentyl)methylamino]-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)NCC2(O)CCCC2)CCCCC1 |
| InChI | InChI=1S/C16H27NO4/c18-13(17-12-16(21)8-4-5-9-16)10-15(11-14(19)20)6-2-1-3-7-15/h21H,1-12H2,(H,17,18)(H,19,20) |
| InChIKey | SMOVNOGYKSXNJV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |