C12H21NO5 — CID 65123303
2-[2-[(1-hydroxycycloheptyl)methylamino]-2-oxoethoxy]acetic acid (PubChem CID 65123303) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[2-[(1-hydroxycycloheptyl)methylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(1-hydroxycycloheptyl)methylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 65123303 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[2-[(1-hydroxycycloheptyl)methylamino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)NCC1(O)CCCCCC1 |
| InChI | InChI=1S/C12H21NO5/c14-10(7-18-8-11(15)16)13-9-12(17)5-3-1-2-4-6-12/h17H,1-9H2,(H,13,14)(H,15,16) |
| InChIKey | YSWVMFCECQCYOU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |