C14H25N3O3 — CID 104678604
4-[2-[1-(aminomethyl)cyclohexyl]acetyl]morpholine-3-carboxamide (PubChem CID 104678604) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[2-[1-(aminomethyl)cyclohexyl]acetyl]morpholine-3-carboxamide.
| Compound Name | 4-[2-[1-(aminomethyl)cyclohexyl]acetyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 104678604 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-[2-[1-(aminomethyl)cyclohexyl]acetyl]morpholine-3-carboxamide |
| SMILES | NCC1(CC(=O)N2CCOCC2C(N)=O)CCCCC1 |
| InChI | InChI=1S/C14H25N3O3/c15-10-14(4-2-1-3-5-14)8-12(18)17-6-7-20-9-11(17)13(16)19/h11H,1-10,15H2,(H2,16,19) |
| InChIKey | JFKWSBIIHTUUPG-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |