C8H13N3O3S — CID 83101281
4-(3-amino-3-sulfanylidenepropanoyl)morpholine-3-carboxamide (PubChem CID 83101281) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(3-amino-3-sulfanylidenepropanoyl)morpholine-3-carboxamide.
| Compound Name | 4-(3-amino-3-sulfanylidenepropanoyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83101281 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-(3-amino-3-sulfanylidenepropanoyl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1C(=O)CC(N)=S |
| InChI | InChI=1S/C8H13N3O3S/c9-6(15)3-7(12)11-1-2-14-4-5(11)8(10)13/h5H,1-4H2,(H2,9,15)(H2,10,13) |
| InChIKey | IQYPEPLQQDGLRX-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|