5-amino-2-(2-hydroxycyclohexyl)pentanoic acid

C11H21NO3 — CID 104681227

IUPAC5-amino-2-(2-hydroxycyclohexyl)pentanoic acid
SMILESNCCCC(C(=O)O)C1CCCCC1O
InChIInChI=1S/C11H21NO3/c12-7-3-5-9(11(14)15)8-4-1-2-6-10(8)13/h8-10,13H,1-7,12H2,(H,14,15)
InChIKeySYZZSQCBJHSBIO-UHFFFAOYSA-N
MW215.29 g/mol
LogP0.98
Rot. Bonds5

About 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid

5-amino-2-(2-hydroxycyclohexyl)pentanoic acid (PubChem CID 104681227) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid.

Molecular Properties

Compound Name5-amino-2-(2-hydroxycyclohexyl)pentanoic acid
PubChem CID104681227
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name5-amino-2-(2-hydroxycyclohexyl)pentanoic acid
SMILESNCCCC(C(=O)O)C1CCCCC1O
InChIInChI=1S/C11H21NO3/c12-7-3-5-9(11(14)15)8-4-1-2-6-10(8)13/h8-10,13H,1-7,12H2,(H,14,15)
InChIKeySYZZSQCBJHSBIO-UHFFFAOYSA-N
XLogP0.98
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 50.98
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-amino-2-(2-hydroxycyclohexyl)butanoic acid
CID 104680966
3-(4-chlorophenyl)-2-(2-hydroxycycloheptyl)propanoic acid
CID 79418786
5-amino-2-cyclopropylpentanamide
CID 142811653
2-(2-hydroxycycloheptyl)propanoic acid
CID 79418512
3-(2-bromophenyl)-2-(2-hydroxycycloheptyl)propanoic acid
CID 79418747
6-amino-2-(cyclopentylamino)hexanoic acid
CID 19080804
magnesium bis(2-(2-hydroxycyclohexyl)butanoate)
CID 119057989
3-(2-bromophenyl)-2-(2-hydroxycyclopentyl)propanoic acid
CID 79418176
2-cyclopentyltridecanoic acid
CID 22665117
8-amino-4-cycloheptyl-1-hydroxyoctan-3-one
CID 170197479
2-cyclohexyldecanoic acid
CID 19004831
2-cyclopentylhept-6-enoic acid
CID 112569181

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid?
The IUPAC name of 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid (CID 104681227) is 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid.
What is the SMILES notation for 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid?
The canonical SMILES for 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid is NCCCC(C(=O)O)C1CCCCC1O.
What is the InChIKey of 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid?
The InChIKey is SYZZSQCBJHSBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c12-7-3-5-9(11(14)15)8-4-1-2-6-10(8)13/h8-10,13H,1-7,12H2,(H,14,15).
What are the key properties of 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid?
5-amino-2-(2-hydroxycyclohexyl)pentanoic acid has a molecular weight of 215.29 g/mol, XLogP of 0.98, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2-hydroxycyclohexyl)pentanoic acid is sourced from PubChem (CID 104681227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).