C15H21N3O — CID 104685798
4-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (PubChem CID 104685798) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
| Compound Name | 4-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 104685798 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| SMILES | CCc1ccc(-c2noc(C(C)CCCN)n2)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-3-12-6-8-13(9-7-12)14-17-15(19-18-14)11(2)5-4-10-16/h6-9,11H,3-5,10,16H2,1-2H3 |
| InChIKey | QVKFNPXQYQVSJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |