C13H12ClN3O — CID 106523542
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile (PubChem CID 106523542) has the molecular formula C13H12ClN3O and a molecular weight of 261.71 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile |
|---|---|
| PubChem CID | 106523542 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile |
| SMILES | CC(CCC#N)c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C13H12ClN3O/c1-9(3-2-8-15)13-16-12(17-18-13)10-4-6-11(14)7-5-10/h4-7,9H,2-3H2,1H3 |
| InChIKey | GZGCHFJNNXQMHX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |