C12H12N4O — CID 106523647
4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)pentanenitrile (PubChem CID 106523647) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)pentanenitrile.
| Compound Name | 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)pentanenitrile |
|---|---|
| PubChem CID | 106523647 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)pentanenitrile |
| SMILES | CC(CCC#N)c1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C12H12N4O/c1-9(5-4-7-13)12-15-11(16-17-12)10-6-2-3-8-14-10/h2-3,6,8-9H,4-5H2,1H3 |
| InChIKey | BHMPCZJOCUDAHW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |