C13H12N4O3 — CID 106524304
4-[3-(2-nitrophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile (PubChem CID 106524304) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[3-(2-nitrophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile.
| Compound Name | 4-[3-(2-nitrophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile |
|---|---|
| PubChem CID | 106524304 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-[3-(2-nitrophenyl)-1,2,4-oxadiazol-5-yl]pentanenitrile |
| SMILES | CC(CCC#N)c1nc(-c2ccccc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C13H12N4O3/c1-9(5-4-8-14)13-15-12(16-20-13)10-6-2-3-7-11(10)17(18)19/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | XGWCFDVHKLPHPL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|