C11H11N3O2 — CID 106525159
4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]pentanenitrile (PubChem CID 106525159) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]pentanenitrile.
| Compound Name | 4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]pentanenitrile |
|---|---|
| PubChem CID | 106525159 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-[3-(furan-3-yl)-1,2,4-oxadiazol-5-yl]pentanenitrile |
| SMILES | CC(CCC#N)c1nc(-c2ccoc2)no1 |
| InChI | InChI=1S/C11H11N3O2/c1-8(3-2-5-12)11-13-10(14-16-11)9-4-6-15-7-9/h4,6-8H,2-3H2,1H3 |
| InChIKey | DBASAGUKHCPJOI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |