C10H9ClN2O2 — CID 63345393
1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 63345393) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 63345393 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CC(O)c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-6(14)10-12-9(13-15-10)7-2-4-8(11)5-3-7/h2-6,14H,1H3 |
| InChIKey | QXJNJHVXCHNKPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |