C9H7ClN2O3 — CID 12569996
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanediol (PubChem CID 12569996) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanediol.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanediol |
|---|---|
| PubChem CID | 12569996 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanediol |
| SMILES | OC(O)c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C9H7ClN2O3/c10-6-3-1-5(2-4-6)7-11-8(9(13)14)15-12-7/h1-4,9,13-14H |
| InChIKey | GAJIFZDYEPVGKC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|