C9H16F2N2O3 — CID 104686861
5-(2,2-difluoroethylcarbamoylamino)-2-methylpentanoic acid (PubChem CID 104686861) has the molecular formula C9H16F2N2O3 and a molecular weight of 238.23 g/mol. Its IUPAC name is 5-(2,2-difluoroethylcarbamoylamino)-2-methylpentanoic acid.
| Compound Name | 5-(2,2-difluoroethylcarbamoylamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 104686861 |
| Molecular Formula | C9H16F2N2O3 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-(2,2-difluoroethylcarbamoylamino)-2-methylpentanoic acid |
| SMILES | CC(CCCNC(=O)NCC(F)F)C(=O)O |
| InChI | InChI=1S/C9H16F2N2O3/c1-6(8(14)15)3-2-4-12-9(16)13-5-7(10)11/h6-7H,2-5H2,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | GEZSDJGLBDDIHC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|