C14H17F2NO2 — CID 104687413
5-[[4-(difluoromethoxy)phenyl]methyl]-5-ethylpyrrolidin-2-one (PubChem CID 104687413) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)phenyl]methyl]-5-ethylpyrrolidin-2-one.
| Compound Name | 5-[[4-(difluoromethoxy)phenyl]methyl]-5-ethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 104687413 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-[[4-(difluoromethoxy)phenyl]methyl]-5-ethylpyrrolidin-2-one |
| SMILES | CCC1(Cc2ccc(OC(F)F)cc2)CCC(=O)N1 |
| InChI | InChI=1S/C14H17F2NO2/c1-2-14(8-7-12(18)17-14)9-10-3-5-11(6-4-10)19-13(15)16/h3-6,13H,2,7-9H2,1H3,(H,17,18) |
| InChIKey | WYEFMOCOXIAFRE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |